C22H26FN3O5S — CID 46798952
ethyl 4-[[5-[(4-fluorophenyl)sulfamoyl]-2-methylbenzoyl]amino]piperidine-1-carboxylate (PubChem CID 46798952) has the molecular formula C22H26FN3O5S and a molecular weight of 463.53 g/mol. Its IUPAC name is ethyl 4-[[5-[(4-fluorophenyl)sulfamoyl]-2-methylbenzoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[5-[(4-fluorophenyl)sulfamoyl]-2-methylbenzoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46798952 |
| Molecular Formula | C22H26FN3O5S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | ethyl 4-[[5-[(4-fluorophenyl)sulfamoyl]-2-methylbenzoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2cc(S(=O)(=O)Nc3ccc(F)cc3)ccc2C)CC1 |
| InChI | InChI=1S/C22H26FN3O5S/c1-3-31-22(28)26-12-10-17(11-13-26)24-21(27)20-14-19(9-4-15(20)2)32(29,30)25-18-7-5-16(23)6-8-18/h4-9,14,17,25H,3,10-13H2,1-2H3,(H,24,27) |
| InChIKey | XFUORRMIZXFZJH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |