C21H24FN3O5S — CID 30283129
ethyl 4-[2-[4-[(4-fluorophenyl)sulfonylamino]phenyl]acetyl]piperazine-1-carboxylate (PubChem CID 30283129) has the molecular formula C21H24FN3O5S and a molecular weight of 449.50 g/mol. Its IUPAC name is ethyl 4-[2-[4-[(4-fluorophenyl)sulfonylamino]phenyl]acetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[4-[(4-fluorophenyl)sulfonylamino]phenyl]acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 30283129 |
| Molecular Formula | C21H24FN3O5S |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | ethyl 4-[2-[4-[(4-fluorophenyl)sulfonylamino]phenyl]acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)Cc2ccc(NS(=O)(=O)c3ccc(F)cc3)cc2)CC1 |
| InChI | InChI=1S/C21H24FN3O5S/c1-2-30-21(27)25-13-11-24(12-14-25)20(26)15-16-3-7-18(8-4-16)23-31(28,29)19-9-5-17(22)6-10-19/h3-10,23H,2,11-15H2,1H3 |
| InChIKey | FYTOPYAUCBSWJL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |