C17H16FNO4S — CID 35951214
ethyl (E)-3-[4-[(4-fluorophenyl)sulfonylamino]phenyl]prop-2-enoate (PubChem CID 35951214) has the molecular formula C17H16FNO4S and a molecular weight of 349.38 g/mol. Its IUPAC name is ethyl (E)-3-[4-[(4-fluorophenyl)sulfonylamino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[(4-fluorophenyl)sulfonylamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 35951214 |
| Molecular Formula | C17H16FNO4S |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | ethyl (E)-3-[4-[(4-fluorophenyl)sulfonylamino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(NS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H16FNO4S/c1-2-23-17(20)12-5-13-3-8-15(9-4-13)19-24(21,22)16-10-6-14(18)7-11-16/h3-12,19H,2H2,1H3/b12-5+ |
| InChIKey | HWUYQXCKNVNJRJ-LFYBBSHMSA-N |
| XLogP | 3.20 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|