C24H21FN2O5S — CID 25352936
ethyl (E)-3-[4-[[4-[(4-fluorophenyl)sulfonylamino]benzoyl]amino]phenyl]prop-2-enoate (PubChem CID 25352936) has the molecular formula C24H21FN2O5S and a molecular weight of 468.51 g/mol. Its IUPAC name is ethyl (E)-3-[4-[[4-[(4-fluorophenyl)sulfonylamino]benzoyl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[[4-[(4-fluorophenyl)sulfonylamino]benzoyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 25352936 |
| Molecular Formula | C24H21FN2O5S |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | ethyl (E)-3-[4-[[4-[(4-fluorophenyl)sulfonylamino]benzoyl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(NC(=O)c2ccc(NS(=O)(=O)c3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H21FN2O5S/c1-2-32-23(28)16-5-17-3-10-20(11-4-17)26-24(29)18-6-12-21(13-7-18)27-33(30,31)22-14-8-19(25)9-15-22/h3-16,27H,2H2,1H3,(H,26,29)/b16-5+ |
| InChIKey | ZPOXTHLZQZTBLS-FZSIALSZSA-N |
| XLogP | 4.46 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|