C22H26N2O5S — CID 35893668
ethyl (E)-3-[4-[[4-(tert-butylsulfamoyl)benzoyl]amino]phenyl]prop-2-enoate (PubChem CID 35893668) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is ethyl (E)-3-[4-[[4-(tert-butylsulfamoyl)benzoyl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[[4-(tert-butylsulfamoyl)benzoyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 35893668 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | ethyl (E)-3-[4-[[4-(tert-butylsulfamoyl)benzoyl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(NC(=O)c2ccc(S(=O)(=O)NC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H26N2O5S/c1-5-29-20(25)15-8-16-6-11-18(12-7-16)23-21(26)17-9-13-19(14-10-17)30(27,28)24-22(2,3)4/h6-15,24H,5H2,1-4H3,(H,23,26)/b15-8+ |
| InChIKey | CMYFSLIPZJJSNQ-OVCLIPMQSA-N |
| XLogP | 3.59 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|