C22H29N3O4S — CID 34317793
4-[[4-(tert-butylsulfamoyl)benzoyl]amino]-N,N-diethylbenzamide (PubChem CID 34317793) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is 4-[[4-(tert-butylsulfamoyl)benzoyl]amino]-N,N-diethylbenzamide.
| Compound Name | 4-[[4-(tert-butylsulfamoyl)benzoyl]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 34317793 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 4-[[4-(tert-butylsulfamoyl)benzoyl]amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)c2ccc(S(=O)(=O)NC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H29N3O4S/c1-6-25(7-2)21(27)17-8-12-18(13-9-17)23-20(26)16-10-14-19(15-11-16)30(28,29)24-22(3,4)5/h8-15,24H,6-7H2,1-5H3,(H,23,26) |
| InChIKey | HKPYKRBPIGLGSG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |