C21H23NO5S — CID 72747886
ethyl 5-[4-[(4-methoxyphenyl)sulfonylamino]phenyl]-4-methylpenta-2,4-dienoate (PubChem CID 72747886) has the molecular formula C21H23NO5S and a molecular weight of 401.48 g/mol. Its IUPAC name is ethyl 5-[4-[(4-methoxyphenyl)sulfonylamino]phenyl]-4-methylpenta-2,4-dienoate.
| Compound Name | ethyl 5-[4-[(4-methoxyphenyl)sulfonylamino]phenyl]-4-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 72747886 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | ethyl 5-[4-[(4-methoxyphenyl)sulfonylamino]phenyl]-4-methylpenta-2,4-dienoate |
| SMILES | CCOC(=O)C=CC(C)=Cc1ccc(NS(=O)(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H23NO5S/c1-4-27-21(23)14-5-16(2)15-17-6-8-18(9-7-17)22-28(24,25)20-12-10-19(26-3)11-13-20/h5-15,22H,4H2,1-3H3 |
| InChIKey | IMSSHEQIACIRPM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|