C24H23N3O7S — CID 43029907
[2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] (E)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enoate (PubChem CID 43029907) has the molecular formula C24H23N3O7S and a molecular weight of 497.53 g/mol. Its IUPAC name is [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] (E)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enoate.
| Compound Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] (E)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 43029907 |
| Molecular Formula | C24H23N3O7S |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] (E)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enoate |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(/C=C/C(=O)OCC(=O)NC(=O)c3cccn3C)cc2)cc1 |
| InChI | InChI=1S/C24H23N3O7S/c1-27-15-3-4-21(27)24(30)25-22(28)16-34-23(29)14-7-17-5-12-20(13-6-17)35(31,32)26-18-8-10-19(33-2)11-9-18/h3-15,26H,16H2,1-2H3,(H,25,28,30)/b14-7+ |
| InChIKey | ZNXLWKRXEVOBTQ-VGOFMYFVSA-N |
| XLogP | 2.35 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|