C24H23NO6S — CID 35519063
2-phenoxyethyl (E)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enoate (PubChem CID 35519063) has the molecular formula C24H23NO6S and a molecular weight of 453.52 g/mol. Its IUPAC name is 2-phenoxyethyl (E)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enoate.
| Compound Name | 2-phenoxyethyl (E)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 35519063 |
| Molecular Formula | C24H23NO6S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 2-phenoxyethyl (E)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enoate |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(/C=C/C(=O)OCCOc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H23NO6S/c1-29-21-12-10-20(11-13-21)25-32(27,28)23-14-7-19(8-15-23)9-16-24(26)31-18-17-30-22-5-3-2-4-6-22/h2-16,25H,17-18H2,1H3/b16-9+ |
| InChIKey | MQKNUCJWAHHTGB-CXUHLZMHSA-N |
| XLogP | 4.13 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|