C26H25NO6S — CID 6217472
4-[[4-[(E)-3-(4-butoxyphenyl)prop-2-enoyl]phenyl]sulfonylamino]benzoic acid (PubChem CID 6217472) has the molecular formula C26H25NO6S and a molecular weight of 479.55 g/mol. Its IUPAC name is 4-[[4-[(E)-3-(4-butoxyphenyl)prop-2-enoyl]phenyl]sulfonylamino]benzoic acid.
| Compound Name | 4-[[4-[(E)-3-(4-butoxyphenyl)prop-2-enoyl]phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 6217472 |
| Molecular Formula | C26H25NO6S |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 4-[[4-[(E)-3-(4-butoxyphenyl)prop-2-enoyl]phenyl]sulfonylamino]benzoic acid |
| SMILES | CCCCOc1ccc(/C=C/C(=O)c2ccc(S(=O)(=O)Nc3ccc(C(=O)O)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H25NO6S/c1-2-3-18-33-23-13-4-19(5-14-23)6-17-25(28)20-9-15-24(16-10-20)34(31,32)27-22-11-7-21(8-12-22)26(29)30/h4-17,27H,2-3,18H2,1H3,(H,29,30)/b17-6+ |
| InChIKey | VVOJWQCAYDAUFZ-UBKPWBPPSA-N |
| XLogP | 5.26 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|