C28H28O4 — CID 174464143
1-butoxy-4-ethenylbenzene;4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid (PubChem CID 174464143) has the molecular formula C28H28O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is 1-butoxy-4-ethenylbenzene;4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid.
| Compound Name | 1-butoxy-4-ethenylbenzene;4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 174464143 |
| Molecular Formula | C28H28O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 1-butoxy-4-ethenylbenzene;4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid |
| SMILES | C=Cc1ccc(OCCCC)cc1.O=C(O)c1ccc(/C=C/C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H12O3.C12H16O/c17-15(13-4-2-1-3-5-13)11-8-12-6-9-14(10-7-12)16(18)19;1-3-5-10-13-12-8-6-11(4-2)7-9-12/h1-11H,(H,18,19);4,6-9H,2-3,5,10H2,1H3/b11-8+; |
| InChIKey | HIJNLQWTEMSGCB-YGCVIUNWSA-N |
| XLogP | 6.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|