About 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid;styrene
4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid;styrene (PubChem CID 174464147) has the molecular formula C24H20O3
and a molecular weight of 356.42 g/mol. Its IUPAC name is 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid;styrene.
Molecular Properties
| Compound Name | 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid;styrene |
| PubChem CID | 174464147 |
| Molecular Formula | C24H20O3 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid;styrene |
| SMILES | C=Cc1ccccc1.O=C(O)c1ccc(/C=C/C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H12O3.C8H8/c17-15(13-4-2-1-3-5-13)11-8-12-6-9-14(10-7-12)16(18)19;1-2-8-6-4-3-5-7-8/h1-11H,(H,18,19);2-7H,1H2/b11-8+; |
| InChIKey | LVIWOAUIISTHNL-YGCVIUNWSA-N |
| XLogP | 5.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid;styrene?
The IUPAC name of 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid;styrene (CID 174464147) is 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid;styrene.
What is the SMILES notation for 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid;styrene?
The canonical SMILES for 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid;styrene is C=Cc1ccccc1.O=C(O)c1ccc(/C=C/C(=O)c2ccccc2)cc1.
What is the InChIKey of 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid;styrene?
The InChIKey is LVIWOAUIISTHNL-YGCVIUNWSA-N. The full InChI is InChI=1S/C16H12O3.C8H8/c17-15(13-4-2-1-3-5-13)11-8-12-6-9-14(10-7-12)16(18)19;1-2-8-6-4-3-5-7-8/h1-11H,(H,18,19);2-7H,1H2/b11-8+;.
What are the key properties of 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid;styrene?
4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid;styrene has a molecular weight of 356.42 g/mol, XLogP of 5.61, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoic acid;styrene is sourced from PubChem (CID 174464147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).