C23H36O — CID 91274718
1,3-diphenylprop-2-en-1-one;ethane (PubChem CID 91274718) has the molecular formula C23H36O and a molecular weight of 328.54 g/mol. Its IUPAC name is 1,3-diphenylprop-2-en-1-one;ethane.
| Compound Name | 1,3-diphenylprop-2-en-1-one;ethane |
|---|---|
| PubChem CID | 91274718 |
| Molecular Formula | C23H36O |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.28 |
| IUPAC Name | 1,3-diphenylprop-2-en-1-one;ethane |
| SMILES | CC.CC.CC.CC.O=C(C=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H12O.4C2H6/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13;4*1-2/h1-12H;4*1-2H3 |
| InChIKey | NKCQWVWIAMYXLK-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|