C15H14O4P+ — CID 174799278
dihydroxy(oxo)phosphanium;(E)-1,3-diphenylprop-2-en-1-one (PubChem CID 174799278) has the molecular formula C15H14O4P+ and a molecular weight of 289.25 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;(E)-1,3-diphenylprop-2-en-1-one.
| Compound Name | dihydroxy(oxo)phosphanium;(E)-1,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 174799278 |
| Molecular Formula | C15H14O4P+ |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | dihydroxy(oxo)phosphanium;(E)-1,3-diphenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)c1ccccc1.O=[P+](O)O |
| InChI | InChI=1S/C15H12O.HO3P/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13;1-4(2)3/h1-12H;(H-,1,2,3)/p+1/b12-11+; |
| InChIKey | UDPOYFOERNFDMI-CALJPSDSSA-O |
| XLogP | 3.21 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|