C17H18O2 — CID 146424659
1,3-diphenylprop-2-en-1-one;ethanol (PubChem CID 146424659) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1,3-diphenylprop-2-en-1-one;ethanol.
| Compound Name | 1,3-diphenylprop-2-en-1-one;ethanol |
|---|---|
| PubChem CID | 146424659 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1,3-diphenylprop-2-en-1-one;ethanol |
| SMILES | CCO.O=C(C=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H12O.C2H6O/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13;1-2-3/h1-12H;3H,2H2,1H3 |
| InChIKey | JEJSBPWRDKEKRE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|