C19H17NO — CID 70390442
1,3-diphenylprop-2-en-1-one;1H-pyrrole (PubChem CID 70390442) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is 1,3-diphenylprop-2-en-1-one;1H-pyrrole.
| Compound Name | 1,3-diphenylprop-2-en-1-one;1H-pyrrole |
|---|---|
| PubChem CID | 70390442 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1,3-diphenylprop-2-en-1-one;1H-pyrrole |
| SMILES | O=C(C=Cc1ccccc1)c1ccccc1.c1cc[nH]c1 |
| InChI | InChI=1S/C15H12O.C4H5N/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13;1-2-4-5-3-1/h1-12H;1-5H |
| InChIKey | XAOYCDVANBDUME-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|