C30H24O5 — CID 67873183
1,3-bis(4-hydroxyphenyl)prop-2-en-1-one;3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one (PubChem CID 67873183) has the molecular formula C30H24O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is 1,3-bis(4-hydroxyphenyl)prop-2-en-1-one;3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one.
| Compound Name | 1,3-bis(4-hydroxyphenyl)prop-2-en-1-one;3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 67873183 |
| Molecular Formula | C30H24O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 1,3-bis(4-hydroxyphenyl)prop-2-en-1-one;3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(O)cc1)c1ccc(O)cc1.O=C(C=Cc1ccc(O)cc1)c1ccccc1 |
| InChI | InChI=1S/C15H12O3.C15H12O2/c16-13-6-1-11(2-7-13)3-10-15(18)12-4-8-14(17)9-5-12;16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-10,16-17H;1-11,16H |
| InChIKey | GBPKVBLZNXAORS-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|