C17H14O2 — CID 134140486
(2E,4E)-5-(4-hydroxyphenyl)-1-phenylpenta-2,4-dien-1-one (PubChem CID 134140486) has the molecular formula C17H14O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is (2E,4E)-5-(4-hydroxyphenyl)-1-phenylpenta-2,4-dien-1-one.
| Compound Name | (2E,4E)-5-(4-hydroxyphenyl)-1-phenylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 134140486 |
| Molecular Formula | C17H14O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (2E,4E)-5-(4-hydroxyphenyl)-1-phenylpenta-2,4-dien-1-one |
| SMILES | O=C(/C=C/C=C/c1ccc(O)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H14O2/c18-16-12-10-14(11-13-16)6-4-5-9-17(19)15-7-2-1-3-8-15/h1-13,18H/b6-4+,9-5+ |
| InChIKey | CZQGQSTXDRQRDU-REZHQCRGSA-N |
| XLogP | 3.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|