C17H13N3O — CID 174058318
(4E)-5-(4-azidophenyl)-1-phenylpenta-2,4-dien-1-one (PubChem CID 174058318) has the molecular formula C17H13N3O and a molecular weight of 275.31 g/mol. Its IUPAC name is (4E)-5-(4-azidophenyl)-1-phenylpenta-2,4-dien-1-one.
| Compound Name | (4E)-5-(4-azidophenyl)-1-phenylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 174058318 |
| Molecular Formula | C17H13N3O |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | (4E)-5-(4-azidophenyl)-1-phenylpenta-2,4-dien-1-one |
| SMILES | [N-]=[N+]=Nc1ccc(/C=C/C=CC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H13N3O/c18-20-19-16-12-10-14(11-13-16)6-4-5-9-17(21)15-7-2-1-3-8-15/h1-13H/b6-4+,9-5? |
| InChIKey | PGLCUHGDRQLXOP-KNMNDLNKSA-N |
| XLogP | 5.08 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|