About CID 158206097
CID 158206097 (PubChem CID 158206097) has the molecular formula C15H10N6NaO
and a molecular weight of 313.28 g/mol.
Molecular Properties
| Compound Name | CID 158206097 |
| PubChem CID | 158206097 |
| Molecular Formula | C15H10N6NaO |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | — |
| SMILES | [N-]=[N+]=Nc1ccc(C=CC(=O)c2ccc(N=[N+]=[N-])cc2)cc1.[Na] |
| InChI | InChI=1S/C15H10N6O.Na/c16-20-18-13-6-1-11(2-7-13)3-10-15(22)12-4-8-14(9-5-12)19-21-17;/h1-10H; |
| InChIKey | GBMYZPXORPQZGA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 114.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze CID 158206097 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158206097?
The IUPAC name of CID 158206097 (CID 158206097) is not available.
What is the SMILES notation for CID 158206097?
The canonical SMILES for CID 158206097 is [N-]=[N+]=Nc1ccc(C=CC(=O)c2ccc(N=[N+]=[N-])cc2)cc1.[Na].
What is the InChIKey of CID 158206097?
The InChIKey is GBMYZPXORPQZGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N6O.Na/c16-20-18-13-6-1-11(2-7-13)3-10-15(22)12-4-8-14(9-5-12)19-21-17;/h1-10H;.
What are the key properties of CID 158206097?
CID 158206097 has a molecular weight of 313.28 g/mol, XLogP of 5.09, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158206097 is sourced from PubChem (CID 158206097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).