C15H10N6O — CID 54371309
1,3-bis(3-azidophenyl)prop-2-en-1-one (PubChem CID 54371309) has the molecular formula C15H10N6O and a molecular weight of 290.29 g/mol. Its IUPAC name is 1,3-bis(3-azidophenyl)prop-2-en-1-one.
| Compound Name | 1,3-bis(3-azidophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 54371309 |
| Molecular Formula | C15H10N6O |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1,3-bis(3-azidophenyl)prop-2-en-1-one |
| SMILES | [N-]=[N+]=Nc1cccc(C=CC(=O)c2cccc(N=[N+]=[N-])c2)c1 |
| InChI | InChI=1S/C15H10N6O/c16-20-18-13-5-1-3-11(9-13)7-8-15(22)12-4-2-6-14(10-12)19-21-17/h1-10H |
| InChIKey | UTKFCHPTSQFHAS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 114.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|