About (Z)-1,3-bis(4-azidophenyl)prop-2-en-1-one
(Z)-1,3-bis(4-azidophenyl)prop-2-en-1-one (PubChem CID 91521628) has the molecular formula C15H10N6O
and a molecular weight of 290.29 g/mol. Its IUPAC name is (Z)-1,3-bis(4-azidophenyl)prop-2-en-1-one.
Molecular Properties
| Compound Name | (Z)-1,3-bis(4-azidophenyl)prop-2-en-1-one |
| PubChem CID | 91521628 |
| Molecular Formula | C15H10N6O |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (Z)-1,3-bis(4-azidophenyl)prop-2-en-1-one |
| SMILES | [N-]=[N+]=Nc1ccc(/C=C\C(=O)c2ccc(N=[N+]=[N-])cc2)cc1 |
| InChI | InChI=1S/C15H10N6O/c16-20-18-13-6-1-11(2-7-13)3-10-15(22)12-4-8-14(9-5-12)19-21-17/h1-10H/b10-3- |
| InChIKey | FSAONUPVUVBQHL-KMKOMSMNSA-N |
| XLogP | 5.47 |
| TPSA | 114.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,3-bis(4-azidophenyl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,3-bis(4-azidophenyl)prop-2-en-1-one?
The IUPAC name of (Z)-1,3-bis(4-azidophenyl)prop-2-en-1-one (CID 91521628) is (Z)-1,3-bis(4-azidophenyl)prop-2-en-1-one.
What is the SMILES notation for (Z)-1,3-bis(4-azidophenyl)prop-2-en-1-one?
The canonical SMILES for (Z)-1,3-bis(4-azidophenyl)prop-2-en-1-one is [N-]=[N+]=Nc1ccc(/C=C\C(=O)c2ccc(N=[N+]=[N-])cc2)cc1.
What is the InChIKey of (Z)-1,3-bis(4-azidophenyl)prop-2-en-1-one?
The InChIKey is FSAONUPVUVBQHL-KMKOMSMNSA-N. The full InChI is InChI=1S/C15H10N6O/c16-20-18-13-6-1-11(2-7-13)3-10-15(22)12-4-8-14(9-5-12)19-21-17/h1-10H/b10-3-.
What are the key properties of (Z)-1,3-bis(4-azidophenyl)prop-2-en-1-one?
(Z)-1,3-bis(4-azidophenyl)prop-2-en-1-one has a molecular weight of 290.29 g/mol, XLogP of 5.47, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,3-bis(4-azidophenyl)prop-2-en-1-one is sourced from PubChem (CID 91521628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).