C23H19NO — CID 171377751
(2E,4E)-1-(4-anilinophenyl)-5-phenylpenta-2,4-dien-1-one (PubChem CID 171377751) has the molecular formula C23H19NO and a molecular weight of 325.41 g/mol. Its IUPAC name is (2E,4E)-1-(4-anilinophenyl)-5-phenylpenta-2,4-dien-1-one.
| Compound Name | (2E,4E)-1-(4-anilinophenyl)-5-phenylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 171377751 |
| Molecular Formula | C23H19NO |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (2E,4E)-1-(4-anilinophenyl)-5-phenylpenta-2,4-dien-1-one |
| SMILES | O=C(/C=C/C=C/c1ccccc1)c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C23H19NO/c25-23(14-8-7-11-19-9-3-1-4-10-19)20-15-17-22(18-16-20)24-21-12-5-2-6-13-21/h1-18,24H/b11-7+,14-8+ |
| InChIKey | UAQSCPAYBPHTNP-HPIZBCMHSA-N |
| XLogP | 5.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|