C22H18O2 — CID 6152775
(1E,3E,7E,9E)-1,10-diphenyldeca-1,3,7,9-tetraene-5,6-dione (PubChem CID 6152775) has the molecular formula C22H18O2 and a molecular weight of 314.38 g/mol. Its IUPAC name is (1E,3E,7E,9E)-1,10-diphenyldeca-1,3,7,9-tetraene-5,6-dione.
| Compound Name | (1E,3E,7E,9E)-1,10-diphenyldeca-1,3,7,9-tetraene-5,6-dione |
|---|---|
| PubChem CID | 6152775 |
| Molecular Formula | C22H18O2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (1E,3E,7E,9E)-1,10-diphenyldeca-1,3,7,9-tetraene-5,6-dione |
| SMILES | O=C(/C=C/C=C/c1ccccc1)C(=O)/C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C22H18O2/c23-21(17-9-7-15-19-11-3-1-4-12-19)22(24)18-10-8-16-20-13-5-2-6-14-20/h1-18H/b15-7+,16-8+,17-9+,18-10+ |
| InChIKey | KRSCDLWSPVQHBY-FVRNMFRHSA-N |
| XLogP | 4.66 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|