C28H26O2S2 — CID 6268148
(1E,3E,8E,10E)-6-(1,3-dithiepan-2-ylidene)-1,11-diphenylundeca-1,3,8,10-tetraene-5,7-dione (PubChem CID 6268148) has the molecular formula C28H26O2S2 and a molecular weight of 458.65 g/mol. Its IUPAC name is (1E,3E,8E,10E)-6-(1,3-dithiepan-2-ylidene)-1,11-diphenylundeca-1,3,8,10-tetraene-5,7-dione.
| Compound Name | (1E,3E,8E,10E)-6-(1,3-dithiepan-2-ylidene)-1,11-diphenylundeca-1,3,8,10-tetraene-5,7-dione |
|---|---|
| PubChem CID | 6268148 |
| Molecular Formula | C28H26O2S2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | (1E,3E,8E,10E)-6-(1,3-dithiepan-2-ylidene)-1,11-diphenylundeca-1,3,8,10-tetraene-5,7-dione |
| SMILES | O=C(/C=C/C=C/c1ccccc1)C(C(=O)/C=C/C=C/c1ccccc1)=C1SCCCCS1 |
| InChI | InChI=1S/C28H26O2S2/c29-25(19-9-7-17-23-13-3-1-4-14-23)27(28-31-21-11-12-22-32-28)26(30)20-10-8-18-24-15-5-2-6-16-24/h1-10,13-20H,11-12,21-22H2/b17-7+,18-8+,19-9+,20-10+ |
| InChIKey | SRRUUORGEIWOAG-PXOPUTQYSA-N |
| XLogP | 7.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|