C20H17NO2S2 — CID 11973820
(E)-2-(1,3-dithiolan-2-ylidene)-3-oxo-N,5-diphenylpent-4-enamide (PubChem CID 11973820) has the molecular formula C20H17NO2S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is (E)-2-(1,3-dithiolan-2-ylidene)-3-oxo-N,5-diphenylpent-4-enamide.
| Compound Name | (E)-2-(1,3-dithiolan-2-ylidene)-3-oxo-N,5-diphenylpent-4-enamide |
|---|---|
| PubChem CID | 11973820 |
| Molecular Formula | C20H17NO2S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | (E)-2-(1,3-dithiolan-2-ylidene)-3-oxo-N,5-diphenylpent-4-enamide |
| SMILES | O=C(/C=C/c1ccccc1)C(C(=O)Nc1ccccc1)=C1SCCS1 |
| InChI | InChI=1S/C20H17NO2S2/c22-17(12-11-15-7-3-1-4-8-15)18(20-24-13-14-25-20)19(23)21-16-9-5-2-6-10-16/h1-12H,13-14H2,(H,21,23)/b12-11+ |
| InChIKey | ITVKMFNNFZPFLS-VAWYXSNFSA-N |
| XLogP | 4.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|