C18H15NO2 — CID 59467578
(2E,5E)-4-oxo-N,6-diphenylhexa-2,5-dienamide (PubChem CID 59467578) has the molecular formula C18H15NO2 and a molecular weight of 277.32 g/mol. Its IUPAC name is (2E,5E)-4-oxo-N,6-diphenylhexa-2,5-dienamide.
| Compound Name | (2E,5E)-4-oxo-N,6-diphenylhexa-2,5-dienamide |
|---|---|
| PubChem CID | 59467578 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (2E,5E)-4-oxo-N,6-diphenylhexa-2,5-dienamide |
| SMILES | O=C(/C=C/C(=O)Nc1ccccc1)/C=C/c1ccccc1 |
| InChI | InChI=1S/C18H15NO2/c20-17(12-11-15-7-3-1-4-8-15)13-14-18(21)19-16-9-5-2-6-10-16/h1-14H,(H,19,21)/b12-11+,14-13+ |
| InChIKey | DPTSNMKDARZWPD-LDHFCIDVSA-N |
| XLogP | 3.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|