C17H15NO — CID 3796923
1-anilino-5-phenylpenta-1,4-dien-3-one (PubChem CID 3796923) has the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. Its IUPAC name is 1-anilino-5-phenylpenta-1,4-dien-3-one.
| Compound Name | 1-anilino-5-phenylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 3796923 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 1-anilino-5-phenylpenta-1,4-dien-3-one |
| SMILES | O=C(C=CNc1ccccc1)C=Cc1ccccc1 |
| InChI | InChI=1S/C17H15NO/c19-17(12-11-15-7-3-1-4-8-15)13-14-18-16-9-5-2-6-10-16/h1-14,18H |
| InChIKey | GSUJZZKLMWYTIQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|