C17H19NO — CID 123527291
(E)-N,3-diphenylprop-2-enamide;ethane (PubChem CID 123527291) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is (E)-N,3-diphenylprop-2-enamide;ethane.
| Compound Name | (E)-N,3-diphenylprop-2-enamide;ethane |
|---|---|
| PubChem CID | 123527291 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (E)-N,3-diphenylprop-2-enamide;ethane |
| SMILES | CC.O=C(/C=C/c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C15H13NO.C2H6/c17-15(16-14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13;1-2/h1-12H,(H,16,17);1-2H3/b12-11+; |
| InChIKey | NSNWPSCBDHYQSL-CALJPSDSSA-N |
| XLogP | 4.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|