C19H15NO4 — CID 11099271
(Z)-4-oxo-4-[4-[(E)-3-phenylprop-2-enoyl]anilino]but-2-enoic acid (PubChem CID 11099271) has the molecular formula C19H15NO4 and a molecular weight of 321.33 g/mol. Its IUPAC name is (Z)-4-oxo-4-[4-[(E)-3-phenylprop-2-enoyl]anilino]but-2-enoic acid.
| Compound Name | (Z)-4-oxo-4-[4-[(E)-3-phenylprop-2-enoyl]anilino]but-2-enoic acid |
|---|---|
| PubChem CID | 11099271 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (Z)-4-oxo-4-[4-[(E)-3-phenylprop-2-enoyl]anilino]but-2-enoic acid |
| SMILES | O=C(O)/C=C\C(=O)Nc1ccc(C(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C19H15NO4/c21-17(11-6-14-4-2-1-3-5-14)15-7-9-16(10-8-15)20-18(22)12-13-19(23)24/h1-13H,(H,20,22)(H,23,24)/b11-6+,13-12- |
| InChIKey | CUMGWSWYVRSKEY-SJYPEPLSSA-N |
| XLogP | 3.16 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|