C21H19NO6 — CID 10981804
(Z)-4-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]anilino]-4-oxobut-2-enoic acid (PubChem CID 10981804) has the molecular formula C21H19NO6 and a molecular weight of 381.38 g/mol. Its IUPAC name is (Z)-4-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]anilino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 10981804 |
| Molecular Formula | C21H19NO6 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | (Z)-4-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]anilino]-4-oxobut-2-enoic acid |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(NC(=O)/C=C\C(=O)O)cc2)cc1OC |
| InChI | InChI=1S/C21H19NO6/c1-27-18-10-4-14(13-19(18)28-2)3-9-17(23)15-5-7-16(8-6-15)22-20(24)11-12-21(25)26/h3-13H,1-2H3,(H,22,24)(H,25,26)/b9-3+,12-11- |
| InChIKey | AYPBHAZHVHHDMD-UXQRUXMWSA-N |
| XLogP | 3.18 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|