C16H13NO2 — CID 12588042
(E)-4-oxo-N,4-diphenylbut-2-enamide (PubChem CID 12588042) has the molecular formula C16H13NO2 and a molecular weight of 251.29 g/mol. Its IUPAC name is (E)-4-oxo-N,4-diphenylbut-2-enamide.
| Compound Name | (E)-4-oxo-N,4-diphenylbut-2-enamide |
|---|---|
| PubChem CID | 12588042 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | (E)-4-oxo-N,4-diphenylbut-2-enamide |
| SMILES | O=C(/C=C/C(=O)c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C16H13NO2/c18-15(13-7-3-1-4-8-13)11-12-16(19)17-14-9-5-2-6-10-14/h1-12H,(H,17,19)/b12-11+ |
| InChIKey | WZSDQUTUJMGEAI-VAWYXSNFSA-N |
| XLogP | 3.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|