λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid

C10H10O3Pb — CID 173413891

IUPACλ2-plumbane;4-oxo-4-phenylbut-2-enoic acid
SMILESO=C(O)C=CC(=O)c1ccccc1.[PbH2]
InChIInChI=1S/C10H8O3.Pb.2H/c11-9(6-7-10(12)13)8-4-2-1-3-5-8;;;/h1-7H,(H,12,13);;;
InChIKeyXLUHICMGTKBWIL-UHFFFAOYSA-N
MW385.39 g/mol
LogP0.59
Rot. Bonds3

About λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid

λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid (PubChem CID 173413891) has the molecular formula C10H10O3Pb and a molecular weight of 385.39 g/mol. Its IUPAC name is λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid.

Molecular Properties

Compound Nameλ2-plumbane;4-oxo-4-phenylbut-2-enoic acid
PubChem CID173413891
Molecular FormulaC10H10O3Pb
Molecular Weight385.39 g/mol
Exact Mass386.04
IUPAC Nameλ2-plumbane;4-oxo-4-phenylbut-2-enoic acid
SMILESO=C(O)C=CC(=O)c1ccccc1.[PbH2]
InChIInChI=1S/C10H8O3.Pb.2H/c11-9(6-7-10(12)13)8-4-2-1-3-5-8;;;/h1-7H,(H,12,13);;;
InChIKeyXLUHICMGTKBWIL-UHFFFAOYSA-N
XLogP0.59
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500385.39
LogP ≤ 50.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid?
The IUPAC name of λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid (CID 173413891) is λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid.
What is the SMILES notation for λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid?
The canonical SMILES for λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid is O=C(O)C=CC(=O)c1ccccc1.[PbH2].
What is the InChIKey of λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid?
The InChIKey is XLUHICMGTKBWIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O3.Pb.2H/c11-9(6-7-10(12)13)8-4-2-1-3-5-8;;;/h1-7H,(H,12,13);;;.
What are the key properties of λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid?
λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid has a molecular weight of 385.39 g/mol, XLogP of 0.59, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid is sourced from PubChem (CID 173413891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).