About λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid
λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid (PubChem CID 173413891) has the molecular formula C10H10O3Pb
and a molecular weight of 385.39 g/mol. Its IUPAC name is λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid.
Molecular Properties
| Compound Name | λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid |
| PubChem CID | 173413891 |
| Molecular Formula | C10H10O3Pb |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)c1ccccc1.[PbH2] |
| InChI | InChI=1S/C10H8O3.Pb.2H/c11-9(6-7-10(12)13)8-4-2-1-3-5-8;;;/h1-7H,(H,12,13);;; |
| InChIKey | XLUHICMGTKBWIL-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid?
The IUPAC name of λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid (CID 173413891) is λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid.
What is the SMILES notation for λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid?
The canonical SMILES for λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid is O=C(O)C=CC(=O)c1ccccc1.[PbH2].
What is the InChIKey of λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid?
The InChIKey is XLUHICMGTKBWIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O3.Pb.2H/c11-9(6-7-10(12)13)8-4-2-1-3-5-8;;;/h1-7H,(H,12,13);;;.
What are the key properties of λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid?
λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid has a molecular weight of 385.39 g/mol, XLogP of 0.59, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for λ2-plumbane;4-oxo-4-phenylbut-2-enoic acid is sourced from PubChem (CID 173413891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).