(2E,4E)-4,5-diphenylpenta-2,4-dienoic acid

C17H14O2 — CID 56927310

IUPAC(2E,4E)-4,5-diphenylpenta-2,4-dienoic acid
SMILESO=C(O)/C=C/C(=C\c1ccccc1)c1ccccc1
InChIInChI=1S/C17H14O2/c18-17(19)12-11-16(15-9-5-2-6-10-15)13-14-7-3-1-4-8-14/h1-13H,(H,18,19)/b12-11+,16-13+
InChIKeyJRUKRTFXFXDRIP-VUWKKMCJSA-N
MW250.30 g/mol
LogP3.87
Rot. Bonds4

About (2E,4E)-4,5-diphenylpenta-2,4-dienoic acid

(2E,4E)-4,5-diphenylpenta-2,4-dienoic acid (PubChem CID 56927310) has the molecular formula C17H14O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is (2E,4E)-4,5-diphenylpenta-2,4-dienoic acid.

Molecular Properties

Compound Name(2E,4E)-4,5-diphenylpenta-2,4-dienoic acid
PubChem CID56927310
Molecular FormulaC17H14O2
Molecular Weight250.30 g/mol
Exact Mass250.10
IUPAC Name(2E,4E)-4,5-diphenylpenta-2,4-dienoic acid
SMILESO=C(O)/C=C/C(=C\c1ccccc1)c1ccccc1
InChIInChI=1S/C17H14O2/c18-17(19)12-11-16(15-9-5-2-6-10-15)13-14-7-3-1-4-8-14/h1-13H,(H,18,19)/b12-11+,16-13+
InChIKeyJRUKRTFXFXDRIP-VUWKKMCJSA-N
XLogP3.87
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.30
LogP ≤ 53.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}

Analyze (2E,4E)-4,5-diphenylpenta-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E,4E)-4,5-diphenylpenta-2,4-dienoic acid?
The IUPAC name of (2E,4E)-4,5-diphenylpenta-2,4-dienoic acid (CID 56927310) is (2E,4E)-4,5-diphenylpenta-2,4-dienoic acid.
What is the SMILES notation for (2E,4E)-4,5-diphenylpenta-2,4-dienoic acid?
The canonical SMILES for (2E,4E)-4,5-diphenylpenta-2,4-dienoic acid is O=C(O)/C=C/C(=C\c1ccccc1)c1ccccc1.
What is the InChIKey of (2E,4E)-4,5-diphenylpenta-2,4-dienoic acid?
The InChIKey is JRUKRTFXFXDRIP-VUWKKMCJSA-N. The full InChI is InChI=1S/C17H14O2/c18-17(19)12-11-16(15-9-5-2-6-10-15)13-14-7-3-1-4-8-14/h1-13H,(H,18,19)/b12-11+,16-13+.
What are the key properties of (2E,4E)-4,5-diphenylpenta-2,4-dienoic acid?
(2E,4E)-4,5-diphenylpenta-2,4-dienoic acid has a molecular weight of 250.30 g/mol, XLogP of 3.87, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-4,5-diphenylpenta-2,4-dienoic acid is sourced from PubChem (CID 56927310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).