C17H14O2 — CID 56927310
(2E,4E)-4,5-diphenylpenta-2,4-dienoic acid (PubChem CID 56927310) has the molecular formula C17H14O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is (2E,4E)-4,5-diphenylpenta-2,4-dienoic acid.
| Compound Name | (2E,4E)-4,5-diphenylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 56927310 |
| Molecular Formula | C17H14O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (2E,4E)-4,5-diphenylpenta-2,4-dienoic acid |
| SMILES | O=C(O)/C=C/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H14O2/c18-17(19)12-11-16(15-9-5-2-6-10-15)13-14-7-3-1-4-8-14/h1-13H,(H,18,19)/b12-11+,16-13+ |
| InChIKey | JRUKRTFXFXDRIP-VUWKKMCJSA-N |
| XLogP | 3.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|