C17H13ClO — CID 54542291
4,5-diphenylpenta-2,4-dienoyl chloride (PubChem CID 54542291) has the molecular formula C17H13ClO and a molecular weight of 268.74 g/mol. Its IUPAC name is 4,5-diphenylpenta-2,4-dienoyl chloride.
| Compound Name | 4,5-diphenylpenta-2,4-dienoyl chloride |
|---|---|
| PubChem CID | 54542291 |
| Molecular Formula | C17H13ClO |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 4,5-diphenylpenta-2,4-dienoyl chloride |
| SMILES | O=C(Cl)C=CC(=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H13ClO/c18-17(19)12-11-16(15-9-5-2-6-10-15)13-14-7-3-1-4-8-14/h1-13H |
| InChIKey | ZEBPPRCCHKEVIQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|