C20H20O — CID 102350773
(4E,6Z)-4-methyl-6,7-diphenylhepta-4,6-dien-2-one (PubChem CID 102350773) has the molecular formula C20H20O and a molecular weight of 276.38 g/mol. Its IUPAC name is (4E,6Z)-4-methyl-6,7-diphenylhepta-4,6-dien-2-one.
| Compound Name | (4E,6Z)-4-methyl-6,7-diphenylhepta-4,6-dien-2-one |
|---|---|
| PubChem CID | 102350773 |
| Molecular Formula | C20H20O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (4E,6Z)-4-methyl-6,7-diphenylhepta-4,6-dien-2-one |
| SMILES | CC(=O)C/C(C)=C/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20O/c1-16(13-17(2)21)14-20(19-11-7-4-8-12-19)15-18-9-5-3-6-10-18/h3-12,14-15H,13H2,1-2H3/b16-14+,20-15- |
| InChIKey | MXVDBZZJWMWAOU-GEZYKDBCSA-N |
| XLogP | 5.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|