C16H15NO — CID 42628257
N-[(E)-1,2-diphenylethenyl]acetamide (PubChem CID 42628257) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is N-[(E)-1,2-diphenylethenyl]acetamide.
| Compound Name | N-[(E)-1,2-diphenylethenyl]acetamide |
|---|---|
| PubChem CID | 42628257 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | N-[(E)-1,2-diphenylethenyl]acetamide |
| SMILES | CC(=O)N/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H15NO/c1-13(18)17-16(15-10-6-3-7-11-15)12-14-8-4-2-5-9-14/h2-12H,1H3,(H,17,18)/b16-12+ |
| InChIKey | GQVJHHSEKHCPNC-FOWTUZBSSA-N |
| XLogP | 3.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|