C15H14N2S — CID 23264124
[(Z)-1,2-diphenylethenyl]thiourea (PubChem CID 23264124) has the molecular formula C15H14N2S and a molecular weight of 254.36 g/mol. Its IUPAC name is [(Z)-1,2-diphenylethenyl]thiourea.
| Compound Name | [(Z)-1,2-diphenylethenyl]thiourea |
|---|---|
| PubChem CID | 23264124 |
| Molecular Formula | C15H14N2S |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | [(Z)-1,2-diphenylethenyl]thiourea |
| SMILES | NC(=S)N/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H14N2S/c16-15(18)17-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H,(H3,16,17,18)/b14-11- |
| InChIKey | AGRSYDXZLBPEKT-KAMYIIQDSA-N |
| XLogP | 3.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|