About N-carbamothioylbenzamide;naphthalene
N-carbamothioylbenzamide;naphthalene (PubChem CID 20980035) has the molecular formula C18H16N2OS
and a molecular weight of 308.41 g/mol. Its IUPAC name is N-carbamothioylbenzamide;naphthalene.
Molecular Properties
| Compound Name | N-carbamothioylbenzamide;naphthalene |
| PubChem CID | 20980035 |
| Molecular Formula | C18H16N2OS |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | N-carbamothioylbenzamide;naphthalene |
| SMILES | NC(=S)NC(=O)c1ccccc1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C8H8N2OS/c1-2-6-10-8-4-3-7-9(10)5-1;9-8(12)10-7(11)6-4-2-1-3-5-6/h1-8H;1-5H,(H3,9,10,11,12) |
| InChIKey | BXXRZLKRWSNNJC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-carbamothioylbenzamide;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-carbamothioylbenzamide;naphthalene?
The IUPAC name of N-carbamothioylbenzamide;naphthalene (CID 20980035) is N-carbamothioylbenzamide;naphthalene.
What is the SMILES notation for N-carbamothioylbenzamide;naphthalene?
The canonical SMILES for N-carbamothioylbenzamide;naphthalene is NC(=S)NC(=O)c1ccccc1.c1ccc2ccccc2c1.
What is the InChIKey of N-carbamothioylbenzamide;naphthalene?
The InChIKey is BXXRZLKRWSNNJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C8H8N2OS/c1-2-6-10-8-4-3-7-9(10)5-1;9-8(12)10-7(11)6-4-2-1-3-5-6/h1-8H;1-5H,(H3,9,10,11,12).
What are the key properties of N-carbamothioylbenzamide;naphthalene?
N-carbamothioylbenzamide;naphthalene has a molecular weight of 308.41 g/mol, XLogP of 3.50, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-carbamothioylbenzamide;naphthalene is sourced from PubChem (CID 20980035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).