C28H22N2O2 — CID 2749417
N-[(Z)-2-benzamido-1,2-diphenylethenyl]benzamide (PubChem CID 2749417) has the molecular formula C28H22N2O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-[(Z)-2-benzamido-1,2-diphenylethenyl]benzamide.
| Compound Name | N-[(Z)-2-benzamido-1,2-diphenylethenyl]benzamide |
|---|---|
| PubChem CID | 2749417 |
| Molecular Formula | C28H22N2O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-[(Z)-2-benzamido-1,2-diphenylethenyl]benzamide |
| SMILES | O=C(N/C(=C(\NC(=O)c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H22N2O2/c31-27(23-17-9-3-10-18-23)29-25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)30-28(32)24-19-11-4-12-20-24/h1-20H,(H,29,31)(H,30,32)/b26-25- |
| InChIKey | FLXYELUYMMEJHD-QPLCGJKRSA-N |
| XLogP | 5.37 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|