About benzohydrazide;propane
benzohydrazide;propane (PubChem CID 90709051) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is benzohydrazide;propane.
Molecular Properties
| Compound Name | benzohydrazide;propane |
| PubChem CID | 90709051 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | benzohydrazide;propane |
| SMILES | CCC.NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C7H8N2O.C3H8/c8-9-7(10)6-4-2-1-3-5-6;1-3-2/h1-5H,8H2,(H,9,10);3H2,1-2H3 |
| InChIKey | YBGAIZQRNFBDRO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzohydrazide;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzohydrazide;propane?
The IUPAC name of benzohydrazide;propane (CID 90709051) is benzohydrazide;propane.
What is the SMILES notation for benzohydrazide;propane?
The canonical SMILES for benzohydrazide;propane is CCC.NNC(=O)c1ccccc1.
What is the InChIKey of benzohydrazide;propane?
The InChIKey is YBGAIZQRNFBDRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.C3H8/c8-9-7(10)6-4-2-1-3-5-6;1-3-2/h1-5H,8H2,(H,9,10);3H2,1-2H3.
What are the key properties of benzohydrazide;propane?
benzohydrazide;propane has a molecular weight of 180.25 g/mol, XLogP of 1.71, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzohydrazide;propane is sourced from PubChem (CID 90709051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).