About benzohydrazide;pentane-1-sulfonamide
benzohydrazide;pentane-1-sulfonamide (PubChem CID 67849298) has the molecular formula C12H21N3O3S
and a molecular weight of 287.38 g/mol. Its IUPAC name is benzohydrazide;pentane-1-sulfonamide.
Molecular Properties
| Compound Name | benzohydrazide;pentane-1-sulfonamide |
| PubChem CID | 67849298 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | benzohydrazide;pentane-1-sulfonamide |
| SMILES | CCCCCS(N)(=O)=O.NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C7H8N2O.C5H13NO2S/c8-9-7(10)6-4-2-1-3-5-6;1-2-3-4-5-9(6,7)8/h1-5H,8H2,(H,9,10);2-5H2,1H3,(H2,6,7,8) |
| InChIKey | FUOBURLUXZSFJD-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzohydrazide;pentane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzohydrazide;pentane-1-sulfonamide?
The IUPAC name of benzohydrazide;pentane-1-sulfonamide (CID 67849298) is benzohydrazide;pentane-1-sulfonamide.
What is the SMILES notation for benzohydrazide;pentane-1-sulfonamide?
The canonical SMILES for benzohydrazide;pentane-1-sulfonamide is CCCCCS(N)(=O)=O.NNC(=O)c1ccccc1.
What is the InChIKey of benzohydrazide;pentane-1-sulfonamide?
The InChIKey is FUOBURLUXZSFJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.C5H13NO2S/c8-9-7(10)6-4-2-1-3-5-6;1-2-3-4-5-9(6,7)8/h1-5H,8H2,(H,9,10);2-5H2,1H3,(H2,6,7,8).
What are the key properties of benzohydrazide;pentane-1-sulfonamide?
benzohydrazide;pentane-1-sulfonamide has a molecular weight of 287.38 g/mol, XLogP of 0.76, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzohydrazide;pentane-1-sulfonamide is sourced from PubChem (CID 67849298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).