About benzohydrazide;ethanol;hydrochloride
benzohydrazide;ethanol;hydrochloride (PubChem CID 70295048) has the molecular formula C9H15ClN2O2
and a molecular weight of 218.68 g/mol. Its IUPAC name is benzohydrazide;ethanol;hydrochloride.
Molecular Properties
| Compound Name | benzohydrazide;ethanol;hydrochloride |
| PubChem CID | 70295048 |
| Molecular Formula | C9H15ClN2O2 |
| Molecular Weight | 218.68 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | benzohydrazide;ethanol;hydrochloride |
| SMILES | CCO.Cl.NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C7H8N2O.C2H6O.ClH/c8-9-7(10)6-4-2-1-3-5-6;1-2-3;/h1-5H,8H2,(H,9,10);3H,2H2,1H3;1H |
| InChIKey | MJUBTBQRLZLJRH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.68 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzohydrazide;ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzohydrazide;ethanol;hydrochloride?
The IUPAC name of benzohydrazide;ethanol;hydrochloride (CID 70295048) is benzohydrazide;ethanol;hydrochloride.
What is the SMILES notation for benzohydrazide;ethanol;hydrochloride?
The canonical SMILES for benzohydrazide;ethanol;hydrochloride is CCO.Cl.NNC(=O)c1ccccc1.
What is the InChIKey of benzohydrazide;ethanol;hydrochloride?
The InChIKey is MJUBTBQRLZLJRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.C2H6O.ClH/c8-9-7(10)6-4-2-1-3-5-6;1-2-3;/h1-5H,8H2,(H,9,10);3H,2H2,1H3;1H.
What are the key properties of benzohydrazide;ethanol;hydrochloride?
benzohydrazide;ethanol;hydrochloride has a molecular weight of 218.68 g/mol, XLogP of 0.71, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzohydrazide;ethanol;hydrochloride is sourced from PubChem (CID 70295048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).