About N-ethylbenzamide
N-ethylbenzamide (PubChem CID 160772566) has the molecular formula C18H22N2O2
and a molecular weight of 298.39 g/mol. Its IUPAC name is N-ethylbenzamide.
Molecular Properties
| Compound Name | N-ethylbenzamide |
| PubChem CID | 160772566 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccccc1.CCNC(=O)c1ccccc1 |
| InChI | InChI=1S/2C9H11NO/c2*1-2-10-9(11)8-6-4-3-5-7-8/h2*3-7H,2H2,1H3,(H,10,11) |
| InChIKey | RZMXZNRJTJTQTO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylbenzamide?
The IUPAC name of N-ethylbenzamide (CID 160772566) is N-ethylbenzamide.
What is the SMILES notation for N-ethylbenzamide?
The canonical SMILES for N-ethylbenzamide is CCNC(=O)c1ccccc1.CCNC(=O)c1ccccc1.
What is the InChIKey of N-ethylbenzamide?
The InChIKey is RZMXZNRJTJTQTO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H11NO/c2*1-2-10-9(11)8-6-4-3-5-7-8/h2*3-7H,2H2,1H3,(H,10,11).
What are the key properties of N-ethylbenzamide?
N-ethylbenzamide has a molecular weight of 298.39 g/mol, XLogP of 2.87, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylbenzamide is sourced from PubChem (CID 160772566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).