C23H19N3O — CID 5261756
N-ethyl-2,3-diphenylquinoxaline-6-carboxamide (PubChem CID 5261756) has the molecular formula C23H19N3O and a molecular weight of 353.43 g/mol. Its IUPAC name is N-ethyl-2,3-diphenylquinoxaline-6-carboxamide.
| Compound Name | N-ethyl-2,3-diphenylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 5261756 |
| Molecular Formula | C23H19N3O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | N-ethyl-2,3-diphenylquinoxaline-6-carboxamide |
| SMILES | CCNC(=O)c1ccc2nc(-c3ccccc3)c(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C23H19N3O/c1-2-24-23(27)18-13-14-19-20(15-18)26-22(17-11-7-4-8-12-17)21(25-19)16-9-5-3-6-10-16/h3-15H,2H2,1H3,(H,24,27) |
| InChIKey | GDHPYSGYFQPVIT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |