C29H22N4O2 — CID 5261928
N'-(4-methylbenzoyl)-2,3-diphenylquinoxaline-6-carbohydrazide (PubChem CID 5261928) has the molecular formula C29H22N4O2 and a molecular weight of 458.52 g/mol. Its IUPAC name is N'-(4-methylbenzoyl)-2,3-diphenylquinoxaline-6-carbohydrazide.
| Compound Name | N'-(4-methylbenzoyl)-2,3-diphenylquinoxaline-6-carbohydrazide |
|---|---|
| PubChem CID | 5261928 |
| Molecular Formula | C29H22N4O2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | N'-(4-methylbenzoyl)-2,3-diphenylquinoxaline-6-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2ccc3nc(-c4ccccc4)c(-c4ccccc4)nc3c2)cc1 |
| InChI | InChI=1S/C29H22N4O2/c1-19-12-14-22(15-13-19)28(34)32-33-29(35)23-16-17-24-25(18-23)31-27(21-10-6-3-7-11-21)26(30-24)20-8-4-2-5-9-20/h2-18H,1H3,(H,32,34)(H,33,35) |
| InChIKey | ANEXJFHZLZVVBO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|