C33H21N2O2- — CID 4171467
2,3-bis(4-phenylphenyl)quinoxaline-6-carboxylate (PubChem CID 4171467) has the molecular formula C33H21N2O2- and a molecular weight of 477.54 g/mol. Its IUPAC name is 2,3-bis(4-phenylphenyl)quinoxaline-6-carboxylate.
| Compound Name | 2,3-bis(4-phenylphenyl)quinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 4171467 |
| Molecular Formula | C33H21N2O2- |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 2,3-bis(4-phenylphenyl)quinoxaline-6-carboxylate |
| SMILES | O=C([O-])c1ccc2nc(-c3ccc(-c4ccccc4)cc3)c(-c3ccc(-c4ccccc4)cc3)nc2c1 |
| InChI | InChI=1S/C33H22N2O2/c36-33(37)28-19-20-29-30(21-28)35-32(27-17-13-25(14-18-27)23-9-5-2-6-10-23)31(34-29)26-15-11-24(12-16-26)22-7-3-1-4-8-22/h1-21H,(H,36,37)/p-1 |
| InChIKey | BSXIGUFBRLXXII-UHFFFAOYSA-M |
| XLogP | 6.66 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |