C24H21N3O — CID 3107662
2,3-diphenyl-N-propylquinoxaline-6-carboxamide (PubChem CID 3107662) has the molecular formula C24H21N3O and a molecular weight of 367.45 g/mol. Its IUPAC name is 2,3-diphenyl-N-propylquinoxaline-6-carboxamide.
| Compound Name | 2,3-diphenyl-N-propylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 3107662 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 2,3-diphenyl-N-propylquinoxaline-6-carboxamide |
| SMILES | CCCNC(=O)c1ccc2nc(-c3ccccc3)c(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C24H21N3O/c1-2-15-25-24(28)19-13-14-20-21(16-19)27-23(18-11-7-4-8-12-18)22(26-20)17-9-5-3-6-10-17/h3-14,16H,2,15H2,1H3,(H,25,28) |
| InChIKey | WOGVENODNQXLHH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |