C30H25N3O — CID 16644401
N-(2-ethyl-6-methylphenyl)-2,3-diphenylquinoxaline-6-carboxamide (PubChem CID 16644401) has the molecular formula C30H25N3O and a molecular weight of 443.55 g/mol. Its IUPAC name is N-(2-ethyl-6-methylphenyl)-2,3-diphenylquinoxaline-6-carboxamide.
| Compound Name | N-(2-ethyl-6-methylphenyl)-2,3-diphenylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 16644401 |
| Molecular Formula | C30H25N3O |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | N-(2-ethyl-6-methylphenyl)-2,3-diphenylquinoxaline-6-carboxamide |
| SMILES | CCc1cccc(C)c1NC(=O)c1ccc2nc(-c3ccccc3)c(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C30H25N3O/c1-3-21-16-10-11-20(2)27(21)33-30(34)24-17-18-25-26(19-24)32-29(23-14-8-5-9-15-23)28(31-25)22-12-6-4-7-13-22/h4-19H,3H2,1-2H3,(H,33,34) |
| InChIKey | SBQCRYBLYKQASM-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |