C29H28N4OS — CID 144949051
N-[3-[ethenyl-[(Z)-prop-1-enyl]amino]propyl]-3-phenyl-2-(3-sulfanylphenyl)quinoxaline-6-carboxamide (PubChem CID 144949051) has the molecular formula C29H28N4OS and a molecular weight of 480.64 g/mol. Its IUPAC name is N-[3-[ethenyl-[(Z)-prop-1-enyl]amino]propyl]-3-phenyl-2-(3-sulfanylphenyl)quinoxaline-6-carboxamide.
| Compound Name | N-[3-[ethenyl-[(Z)-prop-1-enyl]amino]propyl]-3-phenyl-2-(3-sulfanylphenyl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 144949051 |
| Molecular Formula | C29H28N4OS |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | N-[3-[ethenyl-[(Z)-prop-1-enyl]amino]propyl]-3-phenyl-2-(3-sulfanylphenyl)quinoxaline-6-carboxamide |
| SMILES | C=CN(/C=C\C)CCCNC(=O)c1ccc2nc(-c3cccc(S)c3)c(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C29H28N4OS/c1-3-17-33(4-2)18-9-16-30-29(34)23-14-15-25-26(20-23)32-27(21-10-6-5-7-11-21)28(31-25)22-12-8-13-24(35)19-22/h3-8,10-15,17,19-20,35H,2,9,16,18H2,1H3,(H,30,34)/b17-3- |
| InChIKey | AUQWPSJQQVBEGE-YPEHOIGNSA-N |
| XLogP | 6.35 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|